C16H19Cl2N3O5 — CID 134811734
(2S)-2-[(2,4-dichloro-5,5-dimethoxy-3-oxo-4-prop-2-enylcyclopenten-1-yl)amino]-3-(1H-imidazol-5-yl)propanoic acid (PubChem CID 134811734) has the molecular formula C16H19Cl2N3O5 and a molecular weight of 404.25 g/mol. Its IUPAC name is (2S)-2-[(2,4-dichloro-5,5-dimethoxy-3-oxo-4-prop-2-enylcyclopenten-1-yl)amino]-3-(1H-imidazol-5-yl)propanoic acid.
| Compound Name | (2S)-2-[(2,4-dichloro-5,5-dimethoxy-3-oxo-4-prop-2-enylcyclopenten-1-yl)amino]-3-(1H-imidazol-5-yl)propanoic acid |
|---|---|
| PubChem CID | 134811734 |
| Molecular Formula | C16H19Cl2N3O5 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | (2S)-2-[(2,4-dichloro-5,5-dimethoxy-3-oxo-4-prop-2-enylcyclopenten-1-yl)amino]-3-(1H-imidazol-5-yl)propanoic acid |
| SMILES | C=CCC1(Cl)C(=O)C(Cl)=C(N[C@@H](Cc2cnc[nH]2)C(=O)O)C1(OC)OC |
| InChI | InChI=1S/C16H19Cl2N3O5/c1-4-5-15(18)13(22)11(17)12(16(15,25-2)26-3)21-10(14(23)24)6-9-7-19-8-20-9/h4,7-8,10,21H,1,5-6H2,2-3H3,(H,19,20)(H,23,24)/t10-,15?/m0/s1 |
| InChIKey | QGQJKNKXJLHOLB-MYHCZTBNSA-N |
| XLogP | 1.57 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|