C11H15ClO3 — CID 10911393
2-chloro-4,4-dimethoxy-3-methyl-5-prop-2-enylcyclopent-2-en-1-one (PubChem CID 10911393) has the molecular formula C11H15ClO3 and a molecular weight of 230.69 g/mol. Its IUPAC name is 2-chloro-4,4-dimethoxy-3-methyl-5-prop-2-enylcyclopent-2-en-1-one.
| Compound Name | 2-chloro-4,4-dimethoxy-3-methyl-5-prop-2-enylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 10911393 |
| Molecular Formula | C11H15ClO3 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 2-chloro-4,4-dimethoxy-3-methyl-5-prop-2-enylcyclopent-2-en-1-one |
| SMILES | C=CCC1C(=O)C(Cl)=C(C)C1(OC)OC |
| InChI | InChI=1S/C11H15ClO3/c1-5-6-8-10(13)9(12)7(2)11(8,14-3)15-4/h5,8H,1,6H2,2-4H3 |
| InChIKey | XQIHLZPGKVELFG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|