C14H20O2 — CID 45097676
(1S,3S,4R,8R)-8-methoxy-1,8-dimethyl-3-prop-2-enylbicyclo[2.2.2]oct-5-en-2-one (PubChem CID 45097676) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is (1S,3S,4R,8R)-8-methoxy-1,8-dimethyl-3-prop-2-enylbicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1S,3S,4R,8R)-8-methoxy-1,8-dimethyl-3-prop-2-enylbicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 45097676 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (1S,3S,4R,8R)-8-methoxy-1,8-dimethyl-3-prop-2-enylbicyclo[2.2.2]oct-5-en-2-one |
| SMILES | C=CC[C@@H]1C(=O)[C@]2(C)C=C[C@H]1[C@](C)(OC)C2 |
| InChI | InChI=1S/C14H20O2/c1-5-6-10-11-7-8-13(2,12(10)15)9-14(11,3)16-4/h5,7-8,10-11H,1,6,9H2,2-4H3/t10-,11+,13+,14+/m0/s1 |
| InChIKey | CILJZCQHBLSLRG-OIMNJJJWSA-N |
| XLogP | 2.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|