C14H18O3 — CID 102052605
(4R)-4-ethenyl-2,2-dimethoxyspiro[4.5]deca-6,9-dien-8-one (PubChem CID 102052605) has the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. Its IUPAC name is (4R)-4-ethenyl-2,2-dimethoxyspiro[4.5]deca-6,9-dien-8-one.
| Compound Name | (4R)-4-ethenyl-2,2-dimethoxyspiro[4.5]deca-6,9-dien-8-one |
|---|---|
| PubChem CID | 102052605 |
| Molecular Formula | C14H18O3 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (4R)-4-ethenyl-2,2-dimethoxyspiro[4.5]deca-6,9-dien-8-one |
| SMILES | C=C[C@H]1CC(OC)(OC)CC12C=CC(=O)C=C2 |
| InChI | InChI=1S/C14H18O3/c1-4-11-9-14(16-2,17-3)10-13(11)7-5-12(15)6-8-13/h4-8,11H,1,9-10H2,2-3H3/t11-/m0/s1 |
| InChIKey | WCSTVVPFDCVZFR-NSHDSACASA-N |
| XLogP | 2.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|