C11H12O2 — CID 102052608
(4R)-4-ethenyl-2-oxaspiro[4.5]deca-6,9-dien-8-one (PubChem CID 102052608) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is (4R)-4-ethenyl-2-oxaspiro[4.5]deca-6,9-dien-8-one.
| Compound Name | (4R)-4-ethenyl-2-oxaspiro[4.5]deca-6,9-dien-8-one |
|---|---|
| PubChem CID | 102052608 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (4R)-4-ethenyl-2-oxaspiro[4.5]deca-6,9-dien-8-one |
| SMILES | C=C[C@H]1COCC12C=CC(=O)C=C2 |
| InChI | InChI=1S/C11H12O2/c1-2-9-7-13-8-11(9)5-3-10(12)4-6-11/h2-6,9H,1,7-8H2/t9-/m0/s1 |
| InChIKey | AUSHCUJTZINNPP-VIFPVBQESA-N |
| XLogP | 1.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|