C10H14O — CID 11240580
(4S,7S)-4,7-bis(ethenyl)-1-oxaspiro[2.4]heptane (PubChem CID 11240580) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (4S,7S)-4,7-bis(ethenyl)-1-oxaspiro[2.4]heptane.
| Compound Name | (4S,7S)-4,7-bis(ethenyl)-1-oxaspiro[2.4]heptane |
|---|---|
| PubChem CID | 11240580 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (4S,7S)-4,7-bis(ethenyl)-1-oxaspiro[2.4]heptane |
| SMILES | C=C[C@@H]1CC[C@@H](C=C)C12CO2 |
| InChI | InChI=1S/C10H14O/c1-3-8-5-6-9(4-2)10(8)7-11-10/h3-4,8-9H,1-2,5-7H2/t8-,9-/m1/s1 |
| InChIKey | HTGWJSFAZSTFGQ-RKDXNWHRSA-N |
| XLogP | 2.15 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|