C8H14O2 — CID 130456562
(1R,2S,5R)-5-ethenyl-1-methylcyclopentane-1,2-diol (PubChem CID 130456562) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is (1R,2S,5R)-5-ethenyl-1-methylcyclopentane-1,2-diol.
| Compound Name | (1R,2S,5R)-5-ethenyl-1-methylcyclopentane-1,2-diol |
|---|---|
| PubChem CID | 130456562 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | (1R,2S,5R)-5-ethenyl-1-methylcyclopentane-1,2-diol |
| SMILES | C=C[C@H]1CC[C@H](O)[C@]1(C)O |
| InChI | InChI=1S/C8H14O2/c1-3-6-4-5-7(9)8(6,2)10/h3,6-7,9-10H,1,4-5H2,2H3/t6-,7-,8+/m0/s1 |
| InChIKey | OKOQQWYRWJNVDG-BIIVOSGPSA-N |
| XLogP | 0.69 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|