C16H20O2 — CID 15197268
(2'R,3aS,5'S,7aR)-2',5'-bis(ethenyl)spiro[3a,4,7,7a-tetrahydro-2-benzofuran-3,1'-cyclopentane]-1-one (PubChem CID 15197268) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (2'R,3aS,5'S,7aR)-2',5'-bis(ethenyl)spiro[3a,4,7,7a-tetrahydro-2-benzofuran-3,1'-cyclopentane]-1-one.
| Compound Name | (2'R,3aS,5'S,7aR)-2',5'-bis(ethenyl)spiro[3a,4,7,7a-tetrahydro-2-benzofuran-3,1'-cyclopentane]-1-one |
|---|---|
| PubChem CID | 15197268 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (2'R,3aS,5'S,7aR)-2',5'-bis(ethenyl)spiro[3a,4,7,7a-tetrahydro-2-benzofuran-3,1'-cyclopentane]-1-one |
| SMILES | C=C[C@@H]1CC[C@H](C=C)C12OC(=O)[C@@H]1CC=CC[C@@H]12 |
| InChI | InChI=1S/C16H20O2/c1-3-11-9-10-12(4-2)16(11)14-8-6-5-7-13(14)15(17)18-16/h3-6,11-14H,1-2,7-10H2/t11-,12+,13-,14+,16?/m1/s1 |
| InChIKey | NVLNMIVCBPPQIV-WSUYCXTLSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|