C10H15NO2 — CID 90971998
3a,4,7,7a-tetrahydroisoindole-1,3-dione;ethane (PubChem CID 90971998) has the molecular formula C10H15NO2 and a molecular weight of 181.24 g/mol. Its IUPAC name is 3a,4,7,7a-tetrahydroisoindole-1,3-dione;ethane.
| Compound Name | 3a,4,7,7a-tetrahydroisoindole-1,3-dione;ethane |
|---|---|
| PubChem CID | 90971998 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 3a,4,7,7a-tetrahydroisoindole-1,3-dione;ethane |
| SMILES | CC.O=C1NC(=O)C2CC=CCC12 |
| InChI | InChI=1S/C8H9NO2.C2H6/c10-7-5-3-1-2-4-6(5)8(11)9-7;1-2/h1-2,5-6H,3-4H2,(H,9,10,11);1-2H3 |
| InChIKey | RXZHOPOCKZSAND-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|