C21H24O3 — CID 101094008
(1S,2R,5R,6S,15S,16S)-2-ethenyl-11-methoxy-18-oxapentacyclo[14.2.1.01,5.06,15.09,14]nonadeca-9(14),10,12-trien-17-one (PubChem CID 101094008) has the molecular formula C21H24O3 and a molecular weight of 324.42 g/mol. Its IUPAC name is (1S,2R,5R,6S,15S,16S)-2-ethenyl-11-methoxy-18-oxapentacyclo[14.2.1.01,5.06,15.09,14]nonadeca-9(14),10,12-trien-17-one.
| Compound Name | (1S,2R,5R,6S,15S,16S)-2-ethenyl-11-methoxy-18-oxapentacyclo[14.2.1.01,5.06,15.09,14]nonadeca-9(14),10,12-trien-17-one |
|---|---|
| PubChem CID | 101094008 |
| Molecular Formula | C21H24O3 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | (1S,2R,5R,6S,15S,16S)-2-ethenyl-11-methoxy-18-oxapentacyclo[14.2.1.01,5.06,15.09,14]nonadeca-9(14),10,12-trien-17-one |
| SMILES | C=C[C@H]1CC[C@@H]2[C@H]3CCc4cc(OC)ccc4[C@@H]3[C@@H]3C[C@@]21OC3=O |
| InChI | InChI=1S/C21H24O3/c1-3-13-5-9-18-16-7-4-12-10-14(23-2)6-8-15(12)19(16)17-11-21(13,18)24-20(17)22/h3,6,8,10,13,16-19H,1,4-5,7,9,11H2,2H3/t13-,16+,17-,18+,19-,21-/m0/s1 |
| InChIKey | HUTYIOKRJCJNOF-FPYOUMHYSA-N |
| XLogP | 3.87 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|