C30H33BrO5 — CID 135025611
dimethyl (8S,9R,13S,14R,17R)-13-(4-bromophenyl)-17-ethenyl-3-methoxy-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-11,11-dicarboxylate (PubChem CID 135025611) has the molecular formula C30H33BrO5 and a molecular weight of 553.49 g/mol. Its IUPAC name is dimethyl (8S,9R,13S,14R,17R)-13-(4-bromophenyl)-17-ethenyl-3-methoxy-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-11,11-dicarboxylate.
| Compound Name | dimethyl (8S,9R,13S,14R,17R)-13-(4-bromophenyl)-17-ethenyl-3-methoxy-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-11,11-dicarboxylate |
|---|---|
| PubChem CID | 135025611 |
| Molecular Formula | C30H33BrO5 |
| Molecular Weight | 553.49 g/mol |
| Exact Mass | 552.15 |
| IUPAC Name | dimethyl (8S,9R,13S,14R,17R)-13-(4-bromophenyl)-17-ethenyl-3-methoxy-7,8,9,12,14,15,16,17-octahydro-6H-cyclopenta[a]phenanthrene-11,11-dicarboxylate |
| SMILES | C=C[C@H]1CC[C@@H]2[C@@H]3CCc4cc(OC)ccc4[C@@H]3C(C(=O)OC)(C(=O)OC)C[C@@]21c1ccc(Br)cc1 |
| InChI | InChI=1S/C30H33BrO5/c1-5-19-9-15-25-24-13-6-18-16-22(34-2)12-14-23(18)26(24)30(27(32)35-3,28(33)36-4)17-29(19,25)20-7-10-21(31)11-8-20/h5,7-8,10-12,14,16,19,24-26H,1,6,9,13,15,17H2,2-4H3/t19-,24-,25+,26-,29+/m0/s1 |
| InChIKey | IWRDSUIEPGHOJJ-XRGLGQJYSA-N |
| XLogP | 5.99 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.49 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|