C19H24O2S — CID 11834063
(1R,10S,11S,14S,15R)-14-ethenyl-4-methoxy-17-thiatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-15-ol (PubChem CID 11834063) has the molecular formula C19H24O2S and a molecular weight of 316.47 g/mol. Its IUPAC name is (1R,10S,11S,14S,15R)-14-ethenyl-4-methoxy-17-thiatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-15-ol.
| Compound Name | (1R,10S,11S,14S,15R)-14-ethenyl-4-methoxy-17-thiatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-15-ol |
|---|---|
| PubChem CID | 11834063 |
| Molecular Formula | C19H24O2S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (1R,10S,11S,14S,15R)-14-ethenyl-4-methoxy-17-thiatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-15-ol |
| SMILES | C=C[C@@H]1CC[C@H]2[C@@H]3CCc4ccc(OC)cc4[C@@H]3SC[C@@]12O |
| InChI | InChI=1S/C19H24O2S/c1-3-13-6-9-17-15-8-5-12-4-7-14(21-2)10-16(12)18(15)22-11-19(13,17)20/h3-4,7,10,13,15,17-18,20H,1,5-6,8-9,11H2,2H3/t13-,15+,17+,18-,19-/m1/s1 |
| InChIKey | PEHBZJHAUFCXGO-DKEKNDPOSA-N |
| XLogP | 3.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|