C19H24O4S — CID 101026378
2-[(1S,10S,11S,14S,15S)-15-hydroxy-4-methoxy-17-oxo-17λ4-thiatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-14-yl]acetaldehyde (PubChem CID 101026378) has the molecular formula C19H24O4S and a molecular weight of 348.46 g/mol. Its IUPAC name is 2-[(1S,10S,11S,14S,15S)-15-hydroxy-4-methoxy-17-oxo-17λ4-thiatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-14-yl]acetaldehyde.
| Compound Name | 2-[(1S,10S,11S,14S,15S)-15-hydroxy-4-methoxy-17-oxo-17λ4-thiatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-14-yl]acetaldehyde |
|---|---|
| PubChem CID | 101026378 |
| Molecular Formula | C19H24O4S |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 2-[(1S,10S,11S,14S,15S)-15-hydroxy-4-methoxy-17-oxo-17λ4-thiatetracyclo[8.7.0.02,7.011,15]heptadeca-2(7),3,5-trien-14-yl]acetaldehyde |
| SMILES | COc1ccc2c(c1)[C@@H]1[C@@H](CC2)[C@@H]2CC[C@@H](CC=O)[C@@]2(O)CS1=O |
| InChI | InChI=1S/C19H24O4S/c1-23-14-5-2-12-3-6-15-17-7-4-13(8-9-20)19(17,21)11-24(22)18(15)16(12)10-14/h2,5,9-10,13,15,17-18,21H,3-4,6-8,11H2,1H3/t13-,15-,17-,18-,19-,24?/m0/s1 |
| InChIKey | NIXMCZPSHNEFAL-DPXFZQKMSA-N |
| XLogP | 2.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|