C11H13BrO2 — CID 13275748
2-bromo-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-ol (PubChem CID 13275748) has the molecular formula C11H13BrO2 and a molecular weight of 257.13 g/mol. Its IUPAC name is 2-bromo-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-ol.
| Compound Name | 2-bromo-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 13275748 |
| Molecular Formula | C11H13BrO2 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2-bromo-6-methoxy-1,2,3,4-tetrahydronaphthalen-1-ol |
| SMILES | COc1ccc2c(c1)CCC(Br)C2O |
| InChI | InChI=1S/C11H13BrO2/c1-14-8-3-4-9-7(6-8)2-5-10(12)11(9)13/h3-4,6,10-11,13H,2,5H2,1H3 |
| InChIKey | CSDLOOIGBHGMMI-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|