C11H11NO — CID 86319053
(1S)-5-methoxy-2,3-dihydro-1H-indene-1-carbonitrile (PubChem CID 86319053) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is (1S)-5-methoxy-2,3-dihydro-1H-indene-1-carbonitrile.
| Compound Name | (1S)-5-methoxy-2,3-dihydro-1H-indene-1-carbonitrile |
|---|---|
| PubChem CID | 86319053 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | (1S)-5-methoxy-2,3-dihydro-1H-indene-1-carbonitrile |
| SMILES | COc1ccc2c(c1)CC[C@@H]2C#N |
| InChI | InChI=1S/C11H11NO/c1-13-10-4-5-11-8(6-10)2-3-9(11)7-12/h4-6,9H,2-3H2,1H3/t9-/m1/s1 |
| InChIKey | LKARGKZNHMEEDA-SECBINFHSA-N |
| XLogP | 2.25 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |