C11H12N2O — CID 102340504
6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carbonitrile (PubChem CID 102340504) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carbonitrile.
| Compound Name | 6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carbonitrile |
|---|---|
| PubChem CID | 102340504 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carbonitrile |
| SMILES | COc1ccc2c(c1)CCNC2C#N |
| InChI | InChI=1S/C11H12N2O/c1-14-9-2-3-10-8(6-9)4-5-13-11(10)7-12/h2-3,6,11,13H,4-5H2,1H3 |
| InChIKey | GMQQCGLOUKRCIE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |