C13H19NO — CID 154454244
5-ethyl-8-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine (PubChem CID 154454244) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is 5-ethyl-8-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine.
| Compound Name | 5-ethyl-8-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine |
|---|---|
| PubChem CID | 154454244 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 5-ethyl-8-methoxy-2,3,4,5-tetrahydro-1H-3-benzazepine |
| SMILES | CCC1CNCCc2cc(OC)ccc21 |
| InChI | InChI=1S/C13H19NO/c1-3-10-9-14-7-6-11-8-12(15-2)4-5-13(10)11/h4-5,8,10,14H,3,6-7,9H2,1-2H3 |
| InChIKey | PCXIMVHXDIGESU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |