C8H7NO3 — CID 58997577
1-hydroxy-1-azaspiro[3.5]nona-5,8-diene-2,7-dione (PubChem CID 58997577) has the molecular formula C8H7NO3 and a molecular weight of 165.15 g/mol. Its IUPAC name is 1-hydroxy-1-azaspiro[3.5]nona-5,8-diene-2,7-dione.
| Compound Name | 1-hydroxy-1-azaspiro[3.5]nona-5,8-diene-2,7-dione |
|---|---|
| PubChem CID | 58997577 |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 1-hydroxy-1-azaspiro[3.5]nona-5,8-diene-2,7-dione |
| SMILES | O=C1C=CC2(C=C1)CC(=O)N2O |
| InChI | InChI=1S/C8H7NO3/c10-6-1-3-8(4-2-6)5-7(11)9(8)12/h1-4,12H,5H2 |
| InChIKey | DGYPZNNXYULRNT-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'} |
|---|