C14H10O2 — CID 14141979
spiro[2H-indene-3,4'-cyclohexa-2,5-diene]-1,1'-dione (PubChem CID 14141979) has the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. Its IUPAC name is spiro[2H-indene-3,4'-cyclohexa-2,5-diene]-1,1'-dione.
| Compound Name | spiro[2H-indene-3,4'-cyclohexa-2,5-diene]-1,1'-dione |
|---|---|
| PubChem CID | 14141979 |
| Molecular Formula | C14H10O2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | spiro[2H-indene-3,4'-cyclohexa-2,5-diene]-1,1'-dione |
| SMILES | O=C1C=CC2(C=C1)CC(=O)c1ccccc12 |
| InChI | InChI=1S/C14H10O2/c15-10-5-7-14(8-6-10)9-13(16)11-3-1-2-4-12(11)14/h1-8H,9H2 |
| InChIKey | QUCQSKXVOYKMJZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |