C13H12OS — CID 142185092
5'-methylspiro[2H-indene-3,3'-2H-thiophene]-1-one (PubChem CID 142185092) has the molecular formula C13H12OS and a molecular weight of 216.31 g/mol. Its IUPAC name is 5'-methylspiro[2H-indene-3,3'-2H-thiophene]-1-one.
| Compound Name | 5'-methylspiro[2H-indene-3,3'-2H-thiophene]-1-one |
|---|---|
| PubChem CID | 142185092 |
| Molecular Formula | C13H12OS |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 5'-methylspiro[2H-indene-3,3'-2H-thiophene]-1-one |
| SMILES | CC1=CC2(CS1)CC(=O)c1ccccc12 |
| InChI | InChI=1S/C13H12OS/c1-9-6-13(8-15-9)7-12(14)10-4-2-3-5-11(10)13/h2-6H,7-8H2,1H3 |
| InChIKey | LBFXWUDBEFOEFG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |