C15H18O — CID 54322685
spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one (PubChem CID 54322685) has the molecular formula C15H18O and a molecular weight of 214.31 g/mol. Its IUPAC name is spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one.
| Compound Name | spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one |
|---|---|
| PubChem CID | 54322685 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one |
| SMILES | O=C1CCC2(CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C15H18O/c16-14-8-11-15(9-4-1-5-10-15)13-7-3-2-6-12(13)14/h2-3,6-7H,1,4-5,8-11H2 |
| InChIKey | SSSYDULXKGVZPL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |