About spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one
spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one (PubChem CID 54322685) has the molecular formula C15H18O
and a molecular weight of 214.31 g/mol. Its IUPAC name is spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one.
Molecular Properties
| Compound Name | spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one |
| PubChem CID | 54322685 |
| Molecular Formula | C15H18O |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one |
| SMILES | O=C1CCC2(CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C15H18O/c16-14-8-11-15(9-4-1-5-10-15)13-7-3-2-6-12(13)14/h2-3,6-7H,1,4-5,8-11H2 |
| InChIKey | SSSYDULXKGVZPL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one?
The IUPAC name of spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one (CID 54322685) is spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one.
What is the SMILES notation for spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one?
The canonical SMILES for spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one is O=C1CCC2(CCCCC2)c2ccccc21.
What is the InChIKey of spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one?
The InChIKey is SSSYDULXKGVZPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O/c16-14-8-11-15(9-4-1-5-10-15)13-7-3-2-6-12(13)14/h2-3,6-7H,1,4-5,8-11H2.
What are the key properties of spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one?
spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one has a molecular weight of 214.31 g/mol, XLogP of 3.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[2,3-dihydronaphthalene-4,1'-cyclohexane]-1-one is sourced from PubChem (CID 54322685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).