C11H14N2O3 — CID 101156960
1-methoxy-8-methoxyimino-1-azaspiro[4.5]deca-6,9-dien-2-one (PubChem CID 101156960) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 1-methoxy-8-methoxyimino-1-azaspiro[4.5]deca-6,9-dien-2-one.
| Compound Name | 1-methoxy-8-methoxyimino-1-azaspiro[4.5]deca-6,9-dien-2-one |
|---|---|
| PubChem CID | 101156960 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1-methoxy-8-methoxyimino-1-azaspiro[4.5]deca-6,9-dien-2-one |
| SMILES | CON=C1C=CC2(C=C1)CCC(=O)N2OC |
| InChI | InChI=1S/C11H14N2O3/c1-15-12-9-3-6-11(7-4-9)8-5-10(14)13(11)16-2/h3-4,6-7H,5,8H2,1-2H3/b12-9- |
| InChIKey | HTXOTTLGLYWXEO-XFXZXTDPSA-N |
| XLogP | 1.04 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|