C8H12O3 — CID 134922373
4,4-dimethoxycyclohex-2-en-1-one (PubChem CID 134922373) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 4,4-dimethoxycyclohex-2-en-1-one.
| Compound Name | 4,4-dimethoxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 134922373 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 4,4-dimethoxycyclohex-2-en-1-one |
| SMILES | COC1(OC)C=CC(=O)CC1 |
| InChI | InChI=1S/C8H12O3/c1-10-8(11-2)5-3-7(9)4-6-8/h3,5H,4,6H2,1-2H3 |
| InChIKey | SYUVFKWHDZXXNT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|