C12H16O — CID 130029054
4,4-dicyclopropylcyclohex-2-en-1-one (PubChem CID 130029054) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 4,4-dicyclopropylcyclohex-2-en-1-one.
| Compound Name | 4,4-dicyclopropylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 130029054 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 4,4-dicyclopropylcyclohex-2-en-1-one |
| SMILES | O=C1C=CC(C2CC2)(C2CC2)CC1 |
| InChI | InChI=1S/C12H16O/c13-11-5-7-12(8-6-11,9-1-2-9)10-3-4-10/h5,7,9-10H,1-4,6,8H2 |
| InChIKey | QSENRDAQMZMZJQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |