C10H14O3 — CID 14068876
4-(1,3-dioxolan-2-yl)-4-methylcyclohex-2-en-1-one (PubChem CID 14068876) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 4-(1,3-dioxolan-2-yl)-4-methylcyclohex-2-en-1-one.
| Compound Name | 4-(1,3-dioxolan-2-yl)-4-methylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 14068876 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 4-(1,3-dioxolan-2-yl)-4-methylcyclohex-2-en-1-one |
| SMILES | CC1(C2OCCO2)C=CC(=O)CC1 |
| InChI | InChI=1S/C10H14O3/c1-10(9-12-6-7-13-9)4-2-8(11)3-5-10/h2,4,9H,3,5-7H2,1H3 |
| InChIKey | YPCZTBSSWFAEMB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |