C26H42O3 — CID 11896409
(1R,3aS,4S,5S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-5-[(1S)-1-methyl-4-oxocyclohex-2-en-1-yl]-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylic acid (PubChem CID 11896409) has the molecular formula C26H42O3 and a molecular weight of 402.62 g/mol. Its IUPAC name is (1R,3aS,4S,5S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-5-[(1S)-1-methyl-4-oxocyclohex-2-en-1-yl]-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylic acid.
| Compound Name | (1R,3aS,4S,5S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-5-[(1S)-1-methyl-4-oxocyclohex-2-en-1-yl]-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylic acid |
|---|---|
| PubChem CID | 11896409 |
| Molecular Formula | C26H42O3 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | (1R,3aS,4S,5S,7aR)-7a-methyl-1-[(2R)-6-methylheptan-2-yl]-5-[(1S)-1-methyl-4-oxocyclohex-2-en-1-yl]-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H](C(=O)O)[C@@H]([C@]3(C)C=CC(=O)CC3)CC[C@]12C |
| InChI | InChI=1S/C26H42O3/c1-17(2)7-6-8-18(3)20-9-10-22-23(24(28)29)21(13-16-26(20,22)5)25(4)14-11-19(27)12-15-25/h11,14,17-18,20-23H,6-10,12-13,15-16H2,1-5H3,(H,28,29)/t18-,20-,21+,22+,23+,25-,26-/m1/s1 |
| InChIKey | YLFAUVCVKUBIFC-LGPRIFOJSA-N |
| XLogP | 6.52 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |