C27H46O3 — CID 574350
methyl 7a-methyl-1-(6-methylheptan-2-yl)-5-(1-methyl-2-oxocyclohexyl)-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate (PubChem CID 574350) has the molecular formula C27H46O3 and a molecular weight of 418.66 g/mol. Its IUPAC name is methyl 7a-methyl-1-(6-methylheptan-2-yl)-5-(1-methyl-2-oxocyclohexyl)-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate.
| Compound Name | methyl 7a-methyl-1-(6-methylheptan-2-yl)-5-(1-methyl-2-oxocyclohexyl)-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate |
|---|---|
| PubChem CID | 574350 |
| Molecular Formula | C27H46O3 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | methyl 7a-methyl-1-(6-methylheptan-2-yl)-5-(1-methyl-2-oxocyclohexyl)-1,2,3,3a,4,5,6,7-octahydroindene-4-carboxylate |
| SMILES | COC(=O)C1C(C2(C)CCCCC2=O)CCC2(C)C(C(C)CCCC(C)C)CCC12 |
| InChI | InChI=1S/C27H46O3/c1-18(2)10-9-11-19(3)20-13-14-21-24(25(29)30-6)22(15-17-26(20,21)4)27(5)16-8-7-12-23(27)28/h18-22,24H,7-17H2,1-6H3 |
| InChIKey | NEXVOLKTCOXRGG-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |