C27H47N — CID 90882273
(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-amine (PubChem CID 90882273) has the molecular formula C27H47N and a molecular weight of 385.68 g/mol. Its IUPAC name is (10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-amine.
| Compound Name | (10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-amine |
|---|---|
| PubChem CID | 90882273 |
| Molecular Formula | C27H47N |
| Molecular Weight | 385.68 g/mol |
| Exact Mass | 385.37 |
| IUPAC Name | (10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-amine |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3C(N)C=C4CCCC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C27H47N/c1-18(2)9-8-10-19(3)21-12-13-22-25-23(14-16-27(21,22)5)26(4)15-7-6-11-20(26)17-24(25)28/h17-19,21-25H,6-16,28H2,1-5H3/t19-,21-,22?,23?,24?,25?,26+,27-/m1/s1 |
| InChIKey | YPCKHIKROJUQDJ-MYRLSRKXSA-N |
| XLogP | 7.36 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.68 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|