C30H52O2 — CID 173415681
3-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl]propane-1,2-diol (PubChem CID 173415681) has the molecular formula C30H52O2 and a molecular weight of 444.74 g/mol. Its IUPAC name is 3-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl]propane-1,2-diol.
| Compound Name | 3-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 173415681 |
| Molecular Formula | C30H52O2 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.40 |
| IUPAC Name | 3-[(10R,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-7-yl]propane-1,2-diol |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2C3C(CC(O)CO)C=C4CCCC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H52O2/c1-20(2)9-8-10-21(3)25-12-13-26-28-22(18-24(32)19-31)17-23-11-6-7-15-29(23,4)27(28)14-16-30(25,26)5/h17,20-22,24-28,31-32H,6-16,18-19H2,1-5H3/t21-,22?,24?,25-,26?,27?,28?,29+,30-/m1/s1 |
| InChIKey | FSVXLFAYFXOBID-HUKPDXQCSA-N |
| XLogP | 7.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|