C28H46O2 — CID 156748541
(1S,2R,11R,12S,15R,16R)-9-hydroxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]tetracyclo[9.7.0.02,7.012,16]octadec-6-en-5-one (PubChem CID 156748541) has the molecular formula C28H46O2 and a molecular weight of 414.67 g/mol. Its IUPAC name is (1S,2R,11R,12S,15R,16R)-9-hydroxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]tetracyclo[9.7.0.02,7.012,16]octadec-6-en-5-one.
| Compound Name | (1S,2R,11R,12S,15R,16R)-9-hydroxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]tetracyclo[9.7.0.02,7.012,16]octadec-6-en-5-one |
|---|---|
| PubChem CID | 156748541 |
| Molecular Formula | C28H46O2 |
| Molecular Weight | 414.67 g/mol |
| Exact Mass | 414.35 |
| IUPAC Name | (1S,2R,11R,12S,15R,16R)-9-hydroxy-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]tetracyclo[9.7.0.02,7.012,16]octadec-6-en-5-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@H]3CC(O)CC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H46O2/c1-18(2)7-6-8-19(3)24-9-10-25-23-17-22(30)16-20-15-21(29)11-13-27(20,4)26(23)12-14-28(24,25)5/h15,18-19,22-26,30H,6-14,16-17H2,1-5H3/t19-,22?,23-,24-,25+,26+,27+,28-/m1/s1 |
| InChIKey | AUOUCXBCLUDFDX-VLSCVKROSA-N |
| XLogP | 6.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.67 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |