C21H25NO — CID 163040845
(2R,5R,6S,9S,13R)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),7,17,19-tetraen-16-one (PubChem CID 163040845) has the molecular formula C21H25NO and a molecular weight of 307.44 g/mol. Its IUPAC name is (2R,5R,6S,9S,13R)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),7,17,19-tetraen-16-one.
| Compound Name | (2R,5R,6S,9S,13R)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),7,17,19-tetraen-16-one |
|---|---|
| PubChem CID | 163040845 |
| Molecular Formula | C21H25NO |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | (2R,5R,6S,9S,13R)-6,13-dimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icosa-1(12),7,17,19-tetraen-16-one |
| SMILES | C[C@@H]1N=C[C@@]23CCC4=C(C=CC5=CC(=O)CC[C@]54C)[C@H]2CC[C@@H]13 |
| InChI | InChI=1S/C21H25NO/c1-13-17-5-6-19-16-4-3-14-11-15(23)7-9-20(14,2)18(16)8-10-21(17,19)12-22-13/h3-4,11-13,17,19H,5-10H2,1-2H3/t13-,17-,19+,20+,21+/m0/s1 |
| InChIKey | NGTKNHSCWXSHGF-RHEATDNASA-N |
| XLogP | 4.43 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |