C24H32O4 — CID 22800109
[(9S,10S,13S,17S)-10-(hydroxymethyl)-13-methyl-3-oxo-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] 2,2-dimethylpropanoate (PubChem CID 22800109) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol. Its IUPAC name is [(9S,10S,13S,17S)-10-(hydroxymethyl)-13-methyl-3-oxo-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] 2,2-dimethylpropanoate.
| Compound Name | [(9S,10S,13S,17S)-10-(hydroxymethyl)-13-methyl-3-oxo-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 22800109 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | [(9S,10S,13S,17S)-10-(hydroxymethyl)-13-methyl-3-oxo-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-17-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)O[C@H]1CCC2=C3C=CC4=CC(=O)CC[C@]4(CO)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C24H32O4/c1-22(2,3)21(27)28-20-8-7-18-17-6-5-15-13-16(26)9-12-24(15,14-25)19(17)10-11-23(18,20)4/h5-6,13,19-20,25H,7-12,14H2,1-4H3/t19-,20-,23-,24+/m0/s1 |
| InChIKey | JLWXIGCRGVUAFQ-NVXDSCFRSA-N |
| XLogP | 4.29 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |