C28H40O2 — CID 162999240
(9R,10R,13R,17S)-17-[(2S,5R)-2-hydroxy-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 162999240) has the molecular formula C28H40O2 and a molecular weight of 408.63 g/mol. Its IUPAC name is (9R,10R,13R,17S)-17-[(2S,5R)-2-hydroxy-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (9R,10R,13R,17S)-17-[(2S,5R)-2-hydroxy-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 162999240 |
| Molecular Formula | C28H40O2 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.30 |
| IUPAC Name | (9R,10R,13R,17S)-17-[(2S,5R)-2-hydroxy-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)[C@@H](C)C=C[C@](C)(O)[C@H]1CCC2=C3C=CC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C28H40O2/c1-18(2)19(3)11-16-28(6,30)25-10-9-23-22-8-7-20-17-21(29)12-14-26(20,4)24(22)13-15-27(23,25)5/h7-8,11,16-19,24-25,30H,9-10,12-15H2,1-6H3/t19-,24-,25-,26-,27-,28-/m0/s1 |
| InChIKey | IIXXOXSSWTZBTQ-LXLNESOMSA-N |
| XLogP | 6.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|