C28H40O4 — CID 156582410
(9R,10R,12R,13R,15S,17R)-12,15-dihydroxy-17-[(E,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 156582410) has the molecular formula C28H40O4 and a molecular weight of 440.62 g/mol. Its IUPAC name is (9R,10R,12R,13R,15S,17R)-12,15-dihydroxy-17-[(E,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (9R,10R,12R,13R,15S,17R)-12,15-dihydroxy-17-[(E,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 156582410 |
| Molecular Formula | C28H40O4 |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.29 |
| IUPAC Name | (9R,10R,12R,13R,15S,17R)-12,15-dihydroxy-17-[(E,2R,5S)-6-hydroxy-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | C[C@H](/C=C/[C@H](C)C(C)(C)O)[C@H]1C[C@H](O)C2=C3C=CC4=CC(=O)CC[C@]4(C)[C@H]3C[C@@H](O)[C@@]21C |
| InChI | InChI=1S/C28H40O4/c1-16(7-8-17(2)26(3,4)32)21-14-23(30)25-20-10-9-18-13-19(29)11-12-27(18,5)22(20)15-24(31)28(21,25)6/h7-10,13,16-17,21-24,30-32H,11-12,14-15H2,1-6H3/b8-7+/t16-,17+,21-,22+,23+,24-,27+,28+/m1/s1 |
| InChIKey | RDZXYBLXIRJYJG-LSJGDYQFSA-N |
| XLogP | 4.52 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|