C28H40O5 — CID 163065900
12,15-dihydroxy-17-[1-(3-hydroxy-4,5,5-trimethyloxolan-2-yl)ethyl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one (PubChem CID 163065900) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is 12,15-dihydroxy-17-[1-(3-hydroxy-4,5,5-trimethyloxolan-2-yl)ethyl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 12,15-dihydroxy-17-[1-(3-hydroxy-4,5,5-trimethyloxolan-2-yl)ethyl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 163065900 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 12,15-dihydroxy-17-[1-(3-hydroxy-4,5,5-trimethyloxolan-2-yl)ethyl]-10,13-dimethyl-1,2,9,11,12,15,16,17-octahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C1OC(C)(C)C(C)C1O)C1CC(O)C2=C3C=CC4=CC(=O)CCC4(C)C3CC(O)C21C |
| InChI | InChI=1S/C28H40O5/c1-14(25-24(32)15(2)26(3,4)33-25)19-12-21(30)23-18-8-7-16-11-17(29)9-10-27(16,5)20(18)13-22(31)28(19,23)6/h7-8,11,14-15,19-22,24-25,30-32H,9-10,12-13H2,1-6H3 |
| InChIKey | FRSKOLKLHJBWOV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |