C24H34O4 — CID 70807667
[(10R,13S)-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-15-yl] 2,2-dimethylpropanoate (PubChem CID 70807667) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is [(10R,13S)-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-15-yl] 2,2-dimethylpropanoate.
| Compound Name | [(10R,13S)-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-15-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 70807667 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | [(10R,13S)-10,13-dimethyl-3,17-dioxo-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-15-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC1CC(=O)[C@@]2(C)CCC3C(CCC4=CC(=O)CC[C@@]43C)C12 |
| InChI | InChI=1S/C24H34O4/c1-22(2,3)21(27)28-18-13-19(26)24(5)11-9-17-16(20(18)24)7-6-14-12-15(25)8-10-23(14,17)4/h12,16-18,20H,6-11,13H2,1-5H3/t16?,17?,18?,20?,23-,24+/m0/s1 |
| InChIKey | YXOZWWWZYWJQIC-QLNKSQGKSA-N |
| XLogP | 4.66 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |