C20H26O2 — CID 143801849
(7S,11R)-7,11-dimethylpentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6,14-dione (PubChem CID 143801849) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (7S,11R)-7,11-dimethylpentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6,14-dione.
| Compound Name | (7S,11R)-7,11-dimethylpentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6,14-dione |
|---|---|
| PubChem CID | 143801849 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (7S,11R)-7,11-dimethylpentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6,14-dione |
| SMILES | C[C@]12CCC(=O)C=C1CCC1C2CC[C@]2(C)C(=O)C3CC3C12 |
| InChI | InChI=1S/C20H26O2/c1-19-7-5-12(21)9-11(19)3-4-13-16(19)6-8-20(2)17(13)14-10-15(14)18(20)22/h9,13-17H,3-8,10H2,1-2H3/t13?,14?,15?,16?,17?,19-,20-/m0/s1 |
| InChIKey | QLMLHJUFSYRIGZ-QORURNSVSA-N |
| XLogP | 3.94 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |