C21H27NO — CID 25126602
(6S,7S,11R)-7,11-dimethyl-14-oxopentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6-carbonitrile (PubChem CID 25126602) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (6S,7S,11R)-7,11-dimethyl-14-oxopentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6-carbonitrile.
| Compound Name | (6S,7S,11R)-7,11-dimethyl-14-oxopentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6-carbonitrile |
|---|---|
| PubChem CID | 25126602 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (6S,7S,11R)-7,11-dimethyl-14-oxopentacyclo[8.8.0.02,7.03,5.011,16]octadec-15-ene-6-carbonitrile |
| SMILES | C[C@]12CCC(=O)C=C1CCC1C2CC[C@@]2(C)C1C1CC1[C@@H]2C#N |
| InChI | InChI=1S/C21H27NO/c1-20-7-5-13(23)9-12(20)3-4-14-17(20)6-8-21(2)18(11-22)15-10-16(15)19(14)21/h9,14-19H,3-8,10H2,1-2H3/t14?,15?,16?,17?,18-,19?,20-,21+/m0/s1 |
| InChIKey | MACBGHWMZKVQGZ-DEUNTNEHSA-N |
| XLogP | 4.51 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |