C19H18O3 — CID 71765832
(10S,13S)-10,13-dimethyl-1,2,12,17-tetrahydrocyclopenta[a]phenanthrene-3,11,16-trione (PubChem CID 71765832) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is (10S,13S)-10,13-dimethyl-1,2,12,17-tetrahydrocyclopenta[a]phenanthrene-3,11,16-trione.
| Compound Name | (10S,13S)-10,13-dimethyl-1,2,12,17-tetrahydrocyclopenta[a]phenanthrene-3,11,16-trione |
|---|---|
| PubChem CID | 71765832 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (10S,13S)-10,13-dimethyl-1,2,12,17-tetrahydrocyclopenta[a]phenanthrene-3,11,16-trione |
| SMILES | C[C@@]12CC(=O)C=C1C1=C(C(=O)C2)[C@@]2(C)CCC(=O)C=C2C=C1 |
| InChI | InChI=1S/C19H18O3/c1-18-9-13(21)8-15(18)14-4-3-11-7-12(20)5-6-19(11,2)17(14)16(22)10-18/h3-4,7-8H,5-6,9-10H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | MUKXFKRGHLAIKM-OALUTQOASA-N |
| XLogP | 3.03 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |