C27H38O — CID 101041466
(10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,12,15,16,17-hexahydrocyclopenta[a]phenanthren-3-one (PubChem CID 101041466) has the molecular formula C27H38O and a molecular weight of 378.60 g/mol. Its IUPAC name is (10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,12,15,16,17-hexahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,12,15,16,17-hexahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 101041466 |
| Molecular Formula | C27H38O |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.29 |
| IUPAC Name | (10S,13R,17R)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,12,15,16,17-hexahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CCC2=C3C=CC4=CC(=O)CC[C@]4(C)C3=CC[C@@]21C |
| InChI | InChI=1S/C27H38O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9-10,14,17-19,23H,6-8,11-13,15-16H2,1-5H3/t19-,23-,26+,27-/m1/s1 |
| InChIKey | FQKNZBMILRIZPQ-BHSMJKLQSA-N |
| XLogP | 7.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |