C8H9NO2 — CID 12654066
(4E)-4-methoxyimino-2-methylcyclohexa-2,5-dien-1-one (PubChem CID 12654066) has the molecular formula C8H9NO2 and a molecular weight of 151.16 g/mol. Its IUPAC name is (4E)-4-methoxyimino-2-methylcyclohexa-2,5-dien-1-one.
| Compound Name | (4E)-4-methoxyimino-2-methylcyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 12654066 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | (4E)-4-methoxyimino-2-methylcyclohexa-2,5-dien-1-one |
| SMILES | CO/N=C1\C=CC(=O)C(C)=C1 |
| InChI | InChI=1S/C8H9NO2/c1-6-5-7(9-11-2)3-4-8(6)10/h3-5H,1-2H3/b9-7+ |
| InChIKey | FKZMLYQGNUWFLV-VQHVLOKHSA-N |
| XLogP | 1.07 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|