C10H18O2Si — CID 10856457
methyl 2-ethenyl-1-trimethylsilylcyclopropane-1-carboxylate (PubChem CID 10856457) has the molecular formula C10H18O2Si and a molecular weight of 198.34 g/mol. Its IUPAC name is methyl 2-ethenyl-1-trimethylsilylcyclopropane-1-carboxylate.
| Compound Name | methyl 2-ethenyl-1-trimethylsilylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 10856457 |
| Molecular Formula | C10H18O2Si |
| Molecular Weight | 198.34 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | methyl 2-ethenyl-1-trimethylsilylcyclopropane-1-carboxylate |
| SMILES | C=CC1CC1(C(=O)OC)[Si](C)(C)C |
| InChI | InChI=1S/C10H18O2Si/c1-6-8-7-10(8,9(11)12-2)13(3,4)5/h6,8H,1,7H2,2-5H3 |
| InChIKey | OMNFMTJRUWOVAP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|