C11H15NO4 — CID 102364818
dimethyl 2-ethenyl-5-methyl-2,3-dihydropyrrole-4,4-dicarboxylate (PubChem CID 102364818) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is dimethyl 2-ethenyl-5-methyl-2,3-dihydropyrrole-4,4-dicarboxylate.
| Compound Name | dimethyl 2-ethenyl-5-methyl-2,3-dihydropyrrole-4,4-dicarboxylate |
|---|---|
| PubChem CID | 102364818 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | dimethyl 2-ethenyl-5-methyl-2,3-dihydropyrrole-4,4-dicarboxylate |
| SMILES | C=CC1CC(C(=O)OC)(C(=O)OC)C(C)=N1 |
| InChI | InChI=1S/C11H15NO4/c1-5-8-6-11(7(2)12-8,9(13)15-3)10(14)16-4/h5,8H,1,6H2,2-4H3 |
| InChIKey | CPEZDRMRJRAOJB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|