C5H6O3 — CID 172773496
4-prop-2-enyl-1,3-dioxetan-2-one (PubChem CID 172773496) has the molecular formula C5H6O3 and a molecular weight of 114.10 g/mol. Its IUPAC name is 4-prop-2-enyl-1,3-dioxetan-2-one.
| Compound Name | 4-prop-2-enyl-1,3-dioxetan-2-one |
|---|---|
| PubChem CID | 172773496 |
| Molecular Formula | C5H6O3 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | 4-prop-2-enyl-1,3-dioxetan-2-one |
| SMILES | C=CCC1OC(=O)O1 |
| InChI | InChI=1S/C5H6O3/c1-2-3-4-7-5(6)8-4/h2,4H,1,3H2 |
| InChIKey | NGUFNPRNIHNSJT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|