C13H18O5 — CID 101074063
(4S,5S)-4-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-5-prop-2-enyl-1,3-dioxolan-2-one (PubChem CID 101074063) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is (4S,5S)-4-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-5-prop-2-enyl-1,3-dioxolan-2-one.
| Compound Name | (4S,5S)-4-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-5-prop-2-enyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 101074063 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (4S,5S)-4-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-5-prop-2-enyl-1,3-dioxolan-2-one |
| SMILES | C=CC[C@@H]1OC(=O)O[C@@H]1[C@H]1OC(C)(C)O[C@H]1C=C |
| InChI | InChI=1S/C13H18O5/c1-5-7-9-10(16-12(14)15-9)11-8(6-2)17-13(3,4)18-11/h5-6,8-11H,1-2,7H2,3-4H3/t8-,9-,10-,11-/m0/s1 |
| InChIKey | ZEGPNGLYUOZUIJ-NAKRPEOUSA-N |
| XLogP | 2.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|