C22H29NO4 — CID 71499963
(4S,5S)-3-tert-butyl-5-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(E)-2-phenylethenyl]-1,3-oxazolidin-2-one (PubChem CID 71499963) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (4S,5S)-3-tert-butyl-5-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(E)-2-phenylethenyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S,5S)-3-tert-butyl-5-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(E)-2-phenylethenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 71499963 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (4S,5S)-3-tert-butyl-5-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]-4-[(E)-2-phenylethenyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1[C@H]1OC(=O)N(C(C)(C)C)[C@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H29NO4/c1-7-17-19(27-22(5,6)26-17)18-16(14-13-15-11-9-8-10-12-15)23(20(24)25-18)21(2,3)4/h7-14,16-19H,1H2,2-6H3/b14-13+/t16-,17-,18-,19-/m0/s1 |
| InChIKey | UBOAXRLGKMXBSZ-XHERKDLZSA-N |
| XLogP | 4.39 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|