C26H29NO6 — CID 11683842
(4R,5S)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-benzyl-5-ethenyl-1,3-oxazolidin-2-one (PubChem CID 11683842) has the molecular formula C26H29NO6 and a molecular weight of 451.52 g/mol. Its IUPAC name is (4R,5S)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-benzyl-5-ethenyl-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-benzyl-5-ethenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11683842 |
| Molecular Formula | C26H29NO6 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.20 |
| IUPAC Name | (4R,5S)-4-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-benzyl-5-ethenyl-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H]1OC(=O)N(Cc2ccccc2)[C@H]1[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C26H29NO6/c1-4-19-20(27(25(28)30-19)15-17-11-7-5-8-12-17)21-22(29-16-18-13-9-6-10-14-18)23-24(31-21)33-26(2,3)32-23/h4-14,19-24H,1,15-16H2,2-3H3/t19-,20+,21+,22-,23+,24+/m0/s1 |
| InChIKey | XZMIJKVQTLQWSE-PAXOCGFSSA-N |
| XLogP | 4.02 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|