C19H23NO5S — CID 102074177
(5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-ethenyl-1,3-oxazolidine-2-thione (PubChem CID 102074177) has the molecular formula C19H23NO5S and a molecular weight of 377.46 g/mol. Its IUPAC name is (5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-ethenyl-1,3-oxazolidine-2-thione.
| Compound Name | (5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-ethenyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 102074177 |
| Molecular Formula | C19H23NO5S |
| Molecular Weight | 377.46 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-3-ethenyl-1,3-oxazolidine-2-thione |
| SMILES | C=CN1C[C@@H]([C@H]2O[C@@H]3OC(C)(C)O[C@@H]3[C@H]2OCc2ccccc2)OC1=S |
| InChI | InChI=1S/C19H23NO5S/c1-4-20-10-13(22-18(20)26)14-15(21-11-12-8-6-5-7-9-12)16-17(23-14)25-19(2,3)24-16/h4-9,13-17H,1,10-11H2,2-3H3/t13-,14+,15-,16+,17+/m0/s1 |
| InChIKey | YSJGAEKLMRPSKU-DMRKSPOLSA-N |
| XLogP | 2.58 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.46 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|