C19H26O6 — CID 23243473
[(5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]oxolan-2-yl]methanol (PubChem CID 23243473) has the molecular formula C19H26O6 and a molecular weight of 350.41 g/mol. Its IUPAC name is [(5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]oxolan-2-yl]methanol.
| Compound Name | [(5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]oxolan-2-yl]methanol |
|---|---|
| PubChem CID | 23243473 |
| Molecular Formula | C19H26O6 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | [(5S)-5-[(3aR,5R,6S,6aR)-2,2-dimethyl-6-phenylmethoxy-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]oxolan-2-yl]methanol |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@@H]3CCC(CO)O3)[C@H](OCc3ccccc3)[C@H]2O1 |
| InChI | InChI=1S/C19H26O6/c1-19(2)24-17-16(21-11-12-6-4-3-5-7-12)15(23-18(17)25-19)14-9-8-13(10-20)22-14/h3-7,13-18,20H,8-11H2,1-2H3/t13?,14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | NUKIVCCSZNXFPT-AKONKWBKSA-N |
| XLogP | 1.99 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |