C28H33NO7 — CID 10720041
(3S,4R)-1-benzyl-3-phenylmethoxy-4-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]azetidin-2-one (PubChem CID 10720041) has the molecular formula C28H33NO7 and a molecular weight of 495.57 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-3-phenylmethoxy-4-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]azetidin-2-one.
| Compound Name | (3S,4R)-1-benzyl-3-phenylmethoxy-4-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]azetidin-2-one |
|---|---|
| PubChem CID | 10720041 |
| Molecular Formula | C28H33NO7 |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | (3S,4R)-1-benzyl-3-phenylmethoxy-4-[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]azetidin-2-one |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H]1OC(C)(C)O[C@H]1O[C@@H]2[C@@H]1[C@H](OCc2ccccc2)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C28H33NO7/c1-27(2)33-22-20(32-26-24(23(22)34-27)35-28(3,4)36-26)19-21(31-16-18-13-9-6-10-14-18)25(30)29(19)15-17-11-7-5-8-12-17/h5-14,19-24,26H,15-16H2,1-4H3/t19-,20-,21+,22+,23+,24-,26-/m1/s1 |
| InChIKey | CWKLQKRRIOOXTF-VRLGWUGASA-N |
| XLogP | 3.38 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |